C40H52N2O3 — CID 135530155
(16R,21R)-5,11,26-tritert-butyl-15,22-diazapentacyclo[22.3.1.13,7.19,13.016,21]triaconta-1(28),3,5,7(30),9(29),10,12,14,22,24,26-undecaene-28,29,30-triol (PubChem CID 135530155) has the molecular formula C40H52N2O3 and a molecular weight of 608.87 g/mol. Its IUPAC name is (16R,21R)-5,11,26-tritert-butyl-15,22-diazapentacyclo[22.3.1.13,7.19,13.016,21]triaconta-1(28),3,5,7(30),9(29),10,12,14,22,24,26-undecaene-28,29,30-triol.
| Compound Name | (16R,21R)-5,11,26-tritert-butyl-15,22-diazapentacyclo[22.3.1.13,7.19,13.016,21]triaconta-1(28),3,5,7(30),9(29),10,12,14,22,24,26-undecaene-28,29,30-triol |
|---|---|
| PubChem CID | 135530155 |
| Molecular Formula | C40H52N2O3 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 608.40 |
| IUPAC Name | (16R,21R)-5,11,26-tritert-butyl-15,22-diazapentacyclo[22.3.1.13,7.19,13.016,21]triaconta-1(28),3,5,7(30),9(29),10,12,14,22,24,26-undecaene-28,29,30-triol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)/C=N\[C@@H]1CCCC[C@H]1/N=C\2 |
| InChI | InChI=1S/C40H52N2O3/c1-38(2,3)30-16-24-14-26-18-31(39(4,5)6)20-28(36(26)44)22-41-33-12-10-11-13-34(33)42-23-29-21-32(40(7,8)9)19-27(37(29)45)15-25(17-30)35(24)43/h16-23,33-34,43-45H,10-15H2,1-9H3/b41-22-,42-23-/t33-,34-/m1/s1 |
| InChIKey | LAONGRICBQVPPE-XZDDEVOBSA-N |
| XLogP | 9.04 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |