C36H48N4O2 — CID 136703455
(4R,9R,19R,24R)-14,29-ditert-butyl-3,10,18,25-tetrazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(30),2,10,12,14,16(32),17,25,27(31),28-decaene-31,32-diol (PubChem CID 136703455) has the molecular formula C36H48N4O2 and a molecular weight of 568.81 g/mol. Its IUPAC name is (4R,9R,19R,24R)-14,29-ditert-butyl-3,10,18,25-tetrazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(30),2,10,12,14,16(32),17,25,27(31),28-decaene-31,32-diol.
| Compound Name | (4R,9R,19R,24R)-14,29-ditert-butyl-3,10,18,25-tetrazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(30),2,10,12,14,16(32),17,25,27(31),28-decaene-31,32-diol |
|---|---|
| PubChem CID | 136703455 |
| Molecular Formula | C36H48N4O2 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | (4R,9R,19R,24R)-14,29-ditert-butyl-3,10,18,25-tetrazapentacyclo[25.3.1.112,16.04,9.019,24]dotriaconta-1(30),2,10,12,14,16(32),17,25,27(31),28-decaene-31,32-diol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)/C=N/[C@@H]1CCCC[C@H]1/N=C\c1cc(C(C)(C)C)cc(c1O)/C=N/[C@@H]1CCCC[C@H]1/N=C\2 |
| InChI | InChI=1S/C36H48N4O2/c1-35(2,3)27-15-23-19-37-29-11-7-9-13-31(29)39-21-25-17-28(36(4,5)6)18-26(34(25)42)22-40-32-14-10-8-12-30(32)38-20-24(16-27)33(23)41/h15-22,29-32,41-42H,7-14H2,1-6H3/b37-19-,38-20+,39-21+,40-22-/t29-,30-,31-,32-/m1/s1 |
| InChIKey | LSSAMGXASJJRLY-FIFXSOTRSA-N |
| XLogP | 7.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |