C36H62N6S2 — CID 102192696
15,31-ditert-butyl-3,7,11,19,23,27-hexazatricyclo[27.3.1.113,17]tetratriaconta-1(32),13,15,17(34),29(33),30-hexaene-33,34-dithiol (PubChem CID 102192696) has the molecular formula C36H62N6S2 and a molecular weight of 643.07 g/mol. Its IUPAC name is 15,31-ditert-butyl-3,7,11,19,23,27-hexazatricyclo[27.3.1.113,17]tetratriaconta-1(32),13,15,17(34),29(33),30-hexaene-33,34-dithiol.
| Compound Name | 15,31-ditert-butyl-3,7,11,19,23,27-hexazatricyclo[27.3.1.113,17]tetratriaconta-1(32),13,15,17(34),29(33),30-hexaene-33,34-dithiol |
|---|---|
| PubChem CID | 102192696 |
| Molecular Formula | C36H62N6S2 |
| Molecular Weight | 643.07 g/mol |
| Exact Mass | 642.45 |
| IUPAC Name | 15,31-ditert-butyl-3,7,11,19,23,27-hexazatricyclo[27.3.1.113,17]tetratriaconta-1(32),13,15,17(34),29(33),30-hexaene-33,34-dithiol |
| SMILES | CC(C)(C)c1cc2c(S)c(c1)CNCCCNCCCNCc1cc(C(C)(C)C)cc(c1S)CNCCCNCCCNC2 |
| InChI | InChI=1S/C36H62N6S2/c1-35(2,3)31-19-27-23-39-15-7-11-37-13-9-17-41-25-29-21-32(36(4,5)6)22-30(34(29)44)26-42-18-10-14-38-12-8-16-40-24-28(20-31)33(27)43/h19-22,37-44H,7-18,23-26H2,1-6H3 |
| InChIKey | MBMNSVKJTQUMAR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.07 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|