C22H19NO4 — CID 136673193
5,6-dimethyl-3-(4-phenylmethoxyphenyl)-1,2-benzoxazole-4,7-diol (PubChem CID 136673193) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 5,6-dimethyl-3-(4-phenylmethoxyphenyl)-1,2-benzoxazole-4,7-diol.
| Compound Name | 5,6-dimethyl-3-(4-phenylmethoxyphenyl)-1,2-benzoxazole-4,7-diol |
|---|---|
| PubChem CID | 136673193 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 5,6-dimethyl-3-(4-phenylmethoxyphenyl)-1,2-benzoxazole-4,7-diol |
| SMILES | Cc1c(C)c(O)c2c(-c3ccc(OCc4ccccc4)cc3)noc2c1O |
| InChI | InChI=1S/C22H19NO4/c1-13-14(2)21(25)22-18(20(13)24)19(23-27-22)16-8-10-17(11-9-16)26-12-15-6-4-3-5-7-15/h3-11,24-25H,12H2,1-2H3 |
| InChIKey | OJICNDHCZOMTCL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|