C19H16BrNO3 — CID 67079311
1-[3-(bromomethyl)-5-(4-phenylmethoxyphenyl)-1,2-oxazol-4-yl]ethanone (PubChem CID 67079311) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is 1-[3-(bromomethyl)-5-(4-phenylmethoxyphenyl)-1,2-oxazol-4-yl]ethanone.
| Compound Name | 1-[3-(bromomethyl)-5-(4-phenylmethoxyphenyl)-1,2-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 67079311 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 1-[3-(bromomethyl)-5-(4-phenylmethoxyphenyl)-1,2-oxazol-4-yl]ethanone |
| SMILES | CC(=O)c1c(CBr)noc1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H16BrNO3/c1-13(22)18-17(11-20)21-24-19(18)15-7-9-16(10-8-15)23-12-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3 |
| InChIKey | BZMJDRWZOBWZLQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|