About CID 136674675
CID 136674675 (PubChem CID 136674675) has the molecular formula C9H13GeO
and a molecular weight of 209.81 g/mol.
Molecular Properties
| Compound Name | CID 136674675 |
| PubChem CID | 136674675 |
| Molecular Formula | C9H13GeO |
| Molecular Weight | 209.81 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | — |
| SMILES | COc1ccc([Ge](C)C)cc1 |
| InChI | InChI=1S/C9H13GeO/c1-10(2)8-4-6-9(11-3)7-5-8/h4-7H,1-3H3 |
| InChIKey | BCHMRRSQCRPKLN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.81 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 136674675 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136674675?
The IUPAC name of CID 136674675 (CID 136674675) is not available.
What is the SMILES notation for CID 136674675?
The canonical SMILES for CID 136674675 is COc1ccc([Ge](C)C)cc1.
What is the InChIKey of CID 136674675?
The InChIKey is BCHMRRSQCRPKLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13GeO/c1-10(2)8-4-6-9(11-3)7-5-8/h4-7H,1-3H3.
What are the key properties of CID 136674675?
CID 136674675 has a molecular weight of 209.81 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136674675 is sourced from PubChem (CID 136674675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).