C16H13F3N2O2 — CID 136677514
(3R)-5-(2-hydroxyphenyl)-2-phenyl-3-(trifluoromethyl)-4H-pyrazol-3-ol (PubChem CID 136677514) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is (3R)-5-(2-hydroxyphenyl)-2-phenyl-3-(trifluoromethyl)-4H-pyrazol-3-ol.
| Compound Name | (3R)-5-(2-hydroxyphenyl)-2-phenyl-3-(trifluoromethyl)-4H-pyrazol-3-ol |
|---|---|
| PubChem CID | 136677514 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (3R)-5-(2-hydroxyphenyl)-2-phenyl-3-(trifluoromethyl)-4H-pyrazol-3-ol |
| SMILES | Oc1ccccc1C1=NN(c2ccccc2)[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H13F3N2O2/c17-16(18,19)15(23)10-13(12-8-4-5-9-14(12)22)20-21(15)11-6-2-1-3-7-11/h1-9,22-23H,10H2/t15-/m1/s1 |
| InChIKey | UYKFPRIDDUAPJS-OAHLLOKOSA-N |
| XLogP | 3.26 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'het_5_C(2)', 'substructure': 'N/A'} |
|---|