C9H13N5O4 — CID 136679454
2-amino-6-[(1R,2S)-1,2,3-trihydroxy(1,2,3-13C3)propyl]-7,8-dihydro-3H-pteridin-4-one (PubChem CID 136679454) has the molecular formula C9H13N5O4 and a molecular weight of 260.20 g/mol. Its IUPAC name is 2-amino-6-[(1R,2S)-1,2,3-trihydroxy(1,2,3-13C3)propyl]-7,8-dihydro-3H-pteridin-4-one.
| Compound Name | 2-amino-6-[(1R,2S)-1,2,3-trihydroxy(1,2,3-13C3)propyl]-7,8-dihydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 136679454 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-amino-6-[(1R,2S)-1,2,3-trihydroxy(1,2,3-13C3)propyl]-7,8-dihydro-3H-pteridin-4-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)N=[13C]([13C@@H](O)[13C@@H](O)[13CH2]O)[13CH2]N2 |
| InChI | InChI=1S/C9H13N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h4,6,15-17H,1-2H2,(H4,10,11,13,14,18)/t4-,6+/m0/s1/i1+1,2+1,3+1,4+1,6+1 |
| InChIKey | YQIFAMYNGGOTFB-BKCBCIQNSA-N |
| XLogP | -2.44 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |