C18H22N8O3 — CID 137062203
N-(4-amino-4-oxobutyl)-4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]benzamide (PubChem CID 137062203) has the molecular formula C18H22N8O3 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]benzamide.
| Compound Name | N-(4-amino-4-oxobutyl)-4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 137062203 |
| Molecular Formula | C18H22N8O3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]benzamide |
| SMILES | NC(=O)CCCNC(=O)c1ccc(NCC2=Nc3c(nc(N)[nH]c3=O)NC2)cc1 |
| InChI | InChI=1S/C18H22N8O3/c19-13(27)2-1-7-21-16(28)10-3-5-11(6-4-10)22-8-12-9-23-15-14(24-12)17(29)26-18(20)25-15/h3-6,22H,1-2,7-9H2,(H2,19,27)(H,21,28)(H4,20,23,25,26,29) |
| InChIKey | ACAIKXDGGVJIMT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 180.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|