C19H23N7O3 — CID 136628232
4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]-N-(1-oxopentan-2-yl)benzamide (PubChem CID 136628232) has the molecular formula C19H23N7O3 and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]-N-(1-oxopentan-2-yl)benzamide.
| Compound Name | 4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]-N-(1-oxopentan-2-yl)benzamide |
|---|---|
| PubChem CID | 136628232 |
| Molecular Formula | C19H23N7O3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]-N-(1-oxopentan-2-yl)benzamide |
| SMILES | CCCC(C=O)NC(=O)c1ccc(NCC2=Nc3c(nc(N)[nH]c3=O)NC2)cc1 |
| InChI | InChI=1S/C19H23N7O3/c1-2-3-13(10-27)24-17(28)11-4-6-12(7-5-11)21-8-14-9-22-16-15(23-14)18(29)26-19(20)25-16/h4-7,10,13,21H,2-3,8-9H2,1H3,(H,24,28)(H4,20,22,25,26,29) |
| InChIKey | URLBSGJZHXHZFA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 154.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|