About 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione
2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione (PubChem CID 136683413) has the molecular formula C48H30N2O4
and a molecular weight of 698.78 g/mol. Its IUPAC name is 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione.
Molecular Properties
| Compound Name | 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione |
| PubChem CID | 136683413 |
| Molecular Formula | C48H30N2O4 |
| Molecular Weight | 698.78 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione |
| SMILES | O=C1c2cc3ccccc3cc2C(=O)c2cc3cc(-c4ccc(/N=C/c5ccccc5O)cc4)c(-c4ccc(/N=C/c5ccccc5O)cc4)cc3cc21 |
| InChI | InChI=1S/C48H30N2O4/c51-45-11-5-3-9-33(45)27-49-37-17-13-29(14-18-37)39-23-35-25-43-44(48(54)42-22-32-8-2-1-7-31(32)21-41(42)47(43)53)26-36(35)24-40(39)30-15-19-38(20-16-30)50-28-34-10-4-6-12-46(34)52/h1-28,51-52H/b49-27+,50-28+ |
| InChIKey | QMSRWUGZASEZFB-GBEOFQBWSA-N |
| XLogP | 11.01 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 698.78 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione?
The IUPAC name of 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione (CID 136683413) is 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione.
What is the SMILES notation for 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione?
The canonical SMILES for 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione is O=C1c2cc3ccccc3cc2C(=O)c2cc3cc(-c4ccc(/N=C/c5ccccc5O)cc4)c(-c4ccc(/N=C/c5ccccc5O)cc4)cc3cc21.
What is the InChIKey of 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione?
The InChIKey is QMSRWUGZASEZFB-GBEOFQBWSA-N. The full InChI is InChI=1S/C48H30N2O4/c51-45-11-5-3-9-33(45)27-49-37-17-13-29(14-18-37)39-23-35-25-43-44(48(54)42-22-32-8-2-1-7-31(32)21-41(42)47(43)53)26-36(35)24-40(39)30-15-19-38(20-16-30)50-28-34-10-4-6-12-46(34)52/h1-28,51-52H/b49-27+,50-28+.
What are the key properties of 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione?
2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione has a molecular weight of 698.78 g/mol, XLogP of 11.01, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[4-[(2-hydroxyphenyl)methylideneamino]phenyl]pentacene-6,13-dione is sourced from PubChem (CID 136683413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).