C31H23NO — CID 136859493
2-[(3,4,5-triphenylphenyl)iminomethyl]phenol (PubChem CID 136859493) has the molecular formula C31H23NO and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[(3,4,5-triphenylphenyl)iminomethyl]phenol.
| Compound Name | 2-[(3,4,5-triphenylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136859493 |
| Molecular Formula | C31H23NO |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[(3,4,5-triphenylphenyl)iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C31H23NO/c33-30-19-11-10-18-26(30)22-32-27-20-28(23-12-4-1-5-13-23)31(25-16-8-3-9-17-25)29(21-27)24-14-6-2-7-15-24/h1-22,33H/b32-22+ |
| InChIKey | DTKAOUMTEIHNAI-WEMUVCOSSA-N |
| XLogP | 8.14 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|