C10H9N3O3 — CID 136690185
N-(2-hydroxy-5-methylphenyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 136690185) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylphenyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-(2-hydroxy-5-methylphenyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 136690185 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-(2-hydroxy-5-methylphenyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Cc1ccc(O)c(NC(=O)c2cnon2)c1 |
| InChI | InChI=1S/C10H9N3O3/c1-6-2-3-9(14)7(4-6)12-10(15)8-5-11-16-13-8/h2-5,14H,1H3,(H,12,15) |
| InChIKey | NDWKPDKTEXQWKD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|