C10H18N5O14P3 — CID 136690886
[[(2R,3S)-5-[(2-amino-5-formamido-6-oxo-1H-pyrimidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136690886) has the molecular formula C10H18N5O14P3 and a molecular weight of 525.20 g/mol. Its IUPAC name is [[(2R,3S)-5-[(2-amino-5-formamido-6-oxo-1H-pyrimidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S)-5-[(2-amino-5-formamido-6-oxo-1H-pyrimidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136690886 |
| Molecular Formula | C10H18N5O14P3 |
| Molecular Weight | 525.20 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | [[(2R,3S)-5-[(2-amino-5-formamido-6-oxo-1H-pyrimidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc(NC2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(NC=O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H18N5O14P3/c11-10-14-8(7(12-3-16)9(18)15-10)13-6-1-4(17)5(27-6)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h3-6,17H,1-2H2,(H,12,16)(H,22,23)(H,24,25)(H2,19,20,21)(H4,11,13,14,15,18)/t4-,5+,6?/m0/s1 |
| InChIKey | ZYUJSEDXZRGOQU-YRZWDFBDSA-N |
| XLogP | -1.85 |
| TPSA | 302.18 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.20 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|