C16H19N4O14P3S — CID 136716570
[[(2R,3S,5R)-5-[2-amino-5-(5-formylthiophen-2-yl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136716570) has the molecular formula C16H19N4O14P3S and a molecular weight of 616.33 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[2-amino-5-(5-formylthiophen-2-yl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[2-amino-5-(5-formylthiophen-2-yl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136716570 |
| Molecular Formula | C16H19N4O14P3S |
| Molecular Weight | 616.33 g/mol |
| Exact Mass | 615.98 |
| IUPAC Name | [[(2R,3S,5R)-5-[2-amino-5-(5-formylthiophen-2-yl)-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(c(-c3ccc(C=O)s3)cn2[C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H19N4O14P3S/c17-16-18-14-13(15(23)19-16)8(11-2-1-7(5-21)38-11)4-20(14)12-3-9(22)10(32-12)6-31-36(27,28)34-37(29,30)33-35(24,25)26/h1-2,4-5,9-10,12,22H,3,6H2,(H,27,28)(H,29,30)(H2,24,25,26)(H3,17,18,19,23)/t9-,10+,12+/m0/s1 |
| InChIKey | IMQVWCOMKLAPGU-HOSYDEDBSA-N |
| XLogP | 0.84 |
| TPSA | 283.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|