C15H16N2O2 — CID 136692612
2-cyclopropyl-4-(2-ethoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 136692612) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2-ethoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(2-ethoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136692612 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-cyclopropyl-4-(2-ethoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | CCOc1ccccc1-c1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C15H16N2O2/c1-2-19-13-6-4-3-5-11(13)12-9-14(18)17-15(16-12)10-7-8-10/h3-6,9-10H,2,7-8H2,1H3,(H,16,17,18) |
| InChIKey | UKTQRQIUCIJMOY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |