C13H9F3N2O — CID 136692778
2-cyclopropyl-4-(2,3,4-trifluorophenyl)-1H-pyrimidin-6-one (PubChem CID 136692778) has the molecular formula C13H9F3N2O and a molecular weight of 266.22 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,3,4-trifluorophenyl)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(2,3,4-trifluorophenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136692778 |
| Molecular Formula | C13H9F3N2O |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-cyclopropyl-4-(2,3,4-trifluorophenyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccc(F)c(F)c2F)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C13H9F3N2O/c14-8-4-3-7(11(15)12(8)16)9-5-10(19)18-13(17-9)6-1-2-6/h3-6H,1-2H2,(H,17,18,19) |
| InChIKey | KHMMELIFLCYCFE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|