About 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one
2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 136692542) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one |
| PubChem CID | 136692542 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(OC)c(-c2cc(=O)[nH]c(C3CC3)n2)c1 |
| InChI | InChI=1S/C15H16N2O3/c1-19-10-5-6-13(20-2)11(7-10)12-8-14(18)17-15(16-12)9-3-4-9/h5-9H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | DAWZWPAVRMDGBP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one?
The IUPAC name of 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one (CID 136692542) is 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one is COc1ccc(OC)c(-c2cc(=O)[nH]c(C3CC3)n2)c1.
What is the InChIKey of 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one?
The InChIKey is DAWZWPAVRMDGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3/c1-19-10-5-6-13(20-2)11(7-10)12-8-14(18)17-15(16-12)9-3-4-9/h5-9H,3-4H2,1-2H3,(H,16,17,18).
What are the key properties of 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one?
2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one has a molecular weight of 272.30 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-(2,5-dimethoxyphenyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136692542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).