C40H32N2O2 — CID 136694433
2-[N-[(1S,2S)-2-[[(2-hydroxyphenyl)-phenylmethylidene]amino]-1,2-diphenylethyl]-C-phenylcarbonimidoyl]phenol (PubChem CID 136694433) has the molecular formula C40H32N2O2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 2-[N-[(1S,2S)-2-[[(2-hydroxyphenyl)-phenylmethylidene]amino]-1,2-diphenylethyl]-C-phenylcarbonimidoyl]phenol.
| Compound Name | 2-[N-[(1S,2S)-2-[[(2-hydroxyphenyl)-phenylmethylidene]amino]-1,2-diphenylethyl]-C-phenylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 136694433 |
| Molecular Formula | C40H32N2O2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 2-[N-[(1S,2S)-2-[[(2-hydroxyphenyl)-phenylmethylidene]amino]-1,2-diphenylethyl]-C-phenylcarbonimidoyl]phenol |
| SMILES | Oc1ccccc1/C(=N/[C@@H](c1ccccc1)[C@@H](/N=C(\c1ccccc1)c1ccccc1O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H32N2O2/c43-35-27-15-13-25-33(35)37(29-17-5-1-6-18-29)41-39(31-21-9-3-10-22-31)40(32-23-11-4-12-24-32)42-38(30-19-7-2-8-20-30)34-26-14-16-28-36(34)44/h1-28,39-40,43-44H/b41-37+,42-38+/t39-,40-/m0/s1 |
| InChIKey | RWKKVWLUCMNPJK-QSWSHSADSA-N |
| XLogP | 8.96 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|