C31H29N3O4 — CID 136695343
2-butyl-6-[2-[[2-hydroxy-3-(2-hydroxyphenyl)phenyl]methylideneamino]ethylamino]benzo[de]isoquinoline-1,3-dione (PubChem CID 136695343) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-butyl-6-[2-[[2-hydroxy-3-(2-hydroxyphenyl)phenyl]methylideneamino]ethylamino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-butyl-6-[2-[[2-hydroxy-3-(2-hydroxyphenyl)phenyl]methylideneamino]ethylamino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 136695343 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-butyl-6-[2-[[2-hydroxy-3-(2-hydroxyphenyl)phenyl]methylideneamino]ethylamino]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCN1C(=O)c2cccc3c(NCC/N=C/c4cccc(-c5ccccc5O)c4O)ccc(c23)C1=O |
| InChI | InChI=1S/C31H29N3O4/c1-2-3-18-34-30(37)24-12-7-11-23-26(15-14-25(28(23)24)31(34)38)33-17-16-32-19-20-8-6-10-22(29(20)36)21-9-4-5-13-27(21)35/h4-15,19,33,35-36H,2-3,16-18H2,1H3/b32-19+ |
| InChIKey | HMTKBSNFEYHNHT-BIZUNTBRSA-N |
| XLogP | 5.85 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|