C26H21ClN2O2 — CID 136701197
(4E)-4-[(Z)-3-(5-chloro-2-hydroxyphenyl)-1-(4-methylphenyl)prop-2-enylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 136701197) has the molecular formula C26H21ClN2O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is (4E)-4-[(Z)-3-(5-chloro-2-hydroxyphenyl)-1-(4-methylphenyl)prop-2-enylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4E)-4-[(Z)-3-(5-chloro-2-hydroxyphenyl)-1-(4-methylphenyl)prop-2-enylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 136701197 |
| Molecular Formula | C26H21ClN2O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (4E)-4-[(Z)-3-(5-chloro-2-hydroxyphenyl)-1-(4-methylphenyl)prop-2-enylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C(\C=C/c1cc(Cl)ccc1O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H21ClN2O2/c1-17-8-10-19(11-9-17)23(14-12-20-16-21(27)13-15-24(20)30)25-18(2)28-29(26(25)31)22-6-4-3-5-7-22/h3-16,30H,1-2H3/b14-12-,25-23+ |
| InChIKey | GTCRVSFIFHERSR-DDTDMLJBSA-N |
| XLogP | 6.24 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|