C46H36N6O2 — CID 6113219
(4Z)-5-methyl-4-[[2-[2-[[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-phenylmethyl]amino]phenyl]anilino]-phenylmethylidene]-2-phenylpyrazol-3-one (PubChem CID 6113219) has the molecular formula C46H36N6O2 and a molecular weight of 704.83 g/mol. Its IUPAC name is (4Z)-5-methyl-4-[[2-[2-[[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-phenylmethyl]amino]phenyl]anilino]-phenylmethylidene]-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-5-methyl-4-[[2-[2-[[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-phenylmethyl]amino]phenyl]anilino]-phenylmethylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 6113219 |
| Molecular Formula | C46H36N6O2 |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | (4Z)-5-methyl-4-[[2-[2-[[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-phenylmethyl]amino]phenyl]anilino]-phenylmethylidene]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C(\Nc1ccccc1-c1ccccc1N/C(=C1/C(=O)N(c2ccccc2)N=C1C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H36N6O2/c1-31-41(45(53)51(49-31)35-23-11-5-12-24-35)43(33-19-7-3-8-20-33)47-39-29-17-15-27-37(39)38-28-16-18-30-40(38)48-44(34-21-9-4-10-22-34)42-32(2)50-52(46(42)54)36-25-13-6-14-26-36/h3-30,47-48H,1-2H3/b43-41-,44-42+ |
| InChIKey | STSONMYZDPCBMO-XAFSAMPKSA-N |
| XLogP | 9.85 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|