C40H32N6O2 — CID 6843684
5-methyl-4-[[2-[[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-phenylmethyl]amino]anilino]-phenylmethylidene]-2-phenylpyrazol-3-one (PubChem CID 6843684) has the molecular formula C40H32N6O2 and a molecular weight of 628.74 g/mol. Its IUPAC name is 5-methyl-4-[[2-[[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-phenylmethyl]amino]anilino]-phenylmethylidene]-2-phenylpyrazol-3-one.
| Compound Name | 5-methyl-4-[[2-[[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-phenylmethyl]amino]anilino]-phenylmethylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 6843684 |
| Molecular Formula | C40H32N6O2 |
| Molecular Weight | 628.74 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 5-methyl-4-[[2-[[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-phenylmethyl]amino]anilino]-phenylmethylidene]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=C(Nc1ccccc1NC(=C1C(=O)N(c2ccccc2)N=C1C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H32N6O2/c1-27-35(39(47)45(43-27)31-21-11-5-12-22-31)37(29-17-7-3-8-18-29)41-33-25-15-16-26-34(33)42-38(30-19-9-4-10-20-30)36-28(2)44-46(40(36)48)32-23-13-6-14-24-32/h3-26,41-42H,1-2H3 |
| InChIKey | ALISLIUSGOASRW-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.74 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|