C44H34N6S2 — CID 6804325
5-methyl-4-[[[3-[[(3-methyl-1-phenyl-5-sulfanylidenepyrazol-4-ylidene)-phenylmethyl]amino]naphthalen-2-yl]amino]-phenylmethylidene]-2-phenylpyrazole-3-thione (PubChem CID 6804325) has the molecular formula C44H34N6S2 and a molecular weight of 710.93 g/mol. Its IUPAC name is 5-methyl-4-[[[3-[[(3-methyl-1-phenyl-5-sulfanylidenepyrazol-4-ylidene)-phenylmethyl]amino]naphthalen-2-yl]amino]-phenylmethylidene]-2-phenylpyrazole-3-thione.
| Compound Name | 5-methyl-4-[[[3-[[(3-methyl-1-phenyl-5-sulfanylidenepyrazol-4-ylidene)-phenylmethyl]amino]naphthalen-2-yl]amino]-phenylmethylidene]-2-phenylpyrazole-3-thione |
|---|---|
| PubChem CID | 6804325 |
| Molecular Formula | C44H34N6S2 |
| Molecular Weight | 710.93 g/mol |
| Exact Mass | 710.23 |
| IUPAC Name | 5-methyl-4-[[[3-[[(3-methyl-1-phenyl-5-sulfanylidenepyrazol-4-ylidene)-phenylmethyl]amino]naphthalen-2-yl]amino]-phenylmethylidene]-2-phenylpyrazole-3-thione |
| SMILES | CC1=NN(c2ccccc2)C(=S)C1=C(Nc1cc2ccccc2cc1NC(=C1C(=S)N(c2ccccc2)N=C1C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H34N6S2/c1-29-39(43(51)49(47-29)35-23-11-5-12-24-35)41(31-17-7-3-8-18-31)45-37-27-33-21-15-16-22-34(33)28-38(37)46-42(32-19-9-4-10-20-32)40-30(2)48-50(44(40)52)36-25-13-6-14-26-36/h3-28,45-46H,1-2H3 |
| InChIKey | FIOYHFYEZBDPIM-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.93 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_H(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|