C15H19N3O2 — CID 136703807
2'-(2-methylpropylimino)spiro[1,3-dihydroisochromene-4,5'-imidazolidine]-4'-one (PubChem CID 136703807) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2'-(2-methylpropylimino)spiro[1,3-dihydroisochromene-4,5'-imidazolidine]-4'-one.
| Compound Name | 2'-(2-methylpropylimino)spiro[1,3-dihydroisochromene-4,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 136703807 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2'-(2-methylpropylimino)spiro[1,3-dihydroisochromene-4,5'-imidazolidine]-4'-one |
| SMILES | CC(C)C/N=C1\NC(=O)C2(COCc3ccccc32)N1 |
| InChI | InChI=1S/C15H19N3O2/c1-10(2)7-16-14-17-13(19)15(18-14)9-20-8-11-5-3-4-6-12(11)15/h3-6,10H,7-9H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | VJIIKZILVYIVSY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|