About CID 100922608
CID 100922608 (PubChem CID 100922608) has the molecular formula C14H18NO2
and a molecular weight of 232.30 g/mol.
Molecular Properties
| Compound Name | CID 100922608 |
| PubChem CID | 100922608 |
| Molecular Formula | C14H18NO2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | — |
| SMILES | CC1(C)COC[C@]2(CCc3ccccc32)N1[O] |
| InChI | InChI=1S/C14H18NO2/c1-13(2)9-17-10-14(15(13)16)8-7-11-5-3-4-6-12(11)14/h3-6H,7-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | QGYLORZTTYVSHS-AWEZNQCLSA-N |
| XLogP | 2.28 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 100922608 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100922608?
The IUPAC name of CID 100922608 (CID 100922608) is not available.
What is the SMILES notation for CID 100922608?
The canonical SMILES for CID 100922608 is CC1(C)COC[C@]2(CCc3ccccc32)N1[O].
What is the InChIKey of CID 100922608?
The InChIKey is QGYLORZTTYVSHS-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H18NO2/c1-13(2)9-17-10-14(15(13)16)8-7-11-5-3-4-6-12(11)14/h3-6H,7-10H2,1-2H3/t14-/m0/s1.
What are the key properties of CID 100922608?
CID 100922608 has a molecular weight of 232.30 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100922608 is sourced from PubChem (CID 100922608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).