C14H17Cl2N3O — CID 136912230
5-(2,3-dichlorophenyl)-5-methyl-2-(2-methylpropylimino)imidazolidin-4-one (PubChem CID 136912230) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-5-methyl-2-(2-methylpropylimino)imidazolidin-4-one.
| Compound Name | 5-(2,3-dichlorophenyl)-5-methyl-2-(2-methylpropylimino)imidazolidin-4-one |
|---|---|
| PubChem CID | 136912230 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-5-methyl-2-(2-methylpropylimino)imidazolidin-4-one |
| SMILES | CC(C)C/N=C1\NC(=O)C(C)(c2cccc(Cl)c2Cl)N1 |
| InChI | InChI=1S/C14H17Cl2N3O/c1-8(2)7-17-13-18-12(20)14(3,19-13)9-5-4-6-10(15)11(9)16/h4-6,8H,7H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | KPZJJVLWLYETSV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|