C12H12N2OSe — CID 136704053
2-benzylselanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 136704053) has the molecular formula C12H12N2OSe and a molecular weight of 279.20 g/mol. Its IUPAC name is 2-benzylselanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-benzylselanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136704053 |
| Molecular Formula | C12H12N2OSe |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-benzylselanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c([Se]Cc2ccccc2)n1 |
| InChI | InChI=1S/C12H12N2OSe/c1-9-7-11(15)14-12(13-9)16-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,13,14,15) |
| InChIKey | FWEMIBZRKAEXAK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|