C18H20N6O — CID 136704313
N-tert-butyl-8-(4-methoxyphenyl)-1H-imidazo[2,1-f]purin-7-amine (PubChem CID 136704313) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is N-tert-butyl-8-(4-methoxyphenyl)-1H-imidazo[2,1-f]purin-7-amine.
| Compound Name | N-tert-butyl-8-(4-methoxyphenyl)-1H-imidazo[2,1-f]purin-7-amine |
|---|---|
| PubChem CID | 136704313 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-tert-butyl-8-(4-methoxyphenyl)-1H-imidazo[2,1-f]purin-7-amine |
| SMILES | COc1ccc(-c2nc3c4[nH]cnc4ncn3c2NC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H20N6O/c1-18(2,3)23-17-13(11-5-7-12(25-4)8-6-11)22-16-14-15(20-9-19-14)21-10-24(16)17/h5-10,23H,1-4H3,(H,19,20) |
| InChIKey | UDKNJYJVCHMYRP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |