C28H32N4O3 — CID 136706064
3-[4-(4-tert-butylphenyl)-3-hydroxy-6-oxo-2H-pyrrolo[3,4-c]pyrrol-1-yl]-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 136706064) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[4-(4-tert-butylphenyl)-3-hydroxy-6-oxo-2H-pyrrolo[3,4-c]pyrrol-1-yl]-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 3-[4-(4-tert-butylphenyl)-3-hydroxy-6-oxo-2H-pyrrolo[3,4-c]pyrrol-1-yl]-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 136706064 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 3-[4-(4-tert-butylphenyl)-3-hydroxy-6-oxo-2H-pyrrolo[3,4-c]pyrrol-1-yl]-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(-c2[nH]c(O)c3c2C(=O)N=C3c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C28H32N4O3/c1-28(2,3)20-12-10-17(11-13-20)23-21-22(27(35)30-23)24(31-26(21)34)18-8-6-9-19(16-18)25(33)29-14-7-15-32(4)5/h6,8-13,16,31,34H,7,14-15H2,1-5H3,(H,29,33) |
| InChIKey | XBZRZINRNVEMSA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|