C13H9BrF3N3O2S — CID 136706599
2-(4-bromophenyl)-2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 136706599) has the molecular formula C13H9BrF3N3O2S and a molecular weight of 408.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 136706599 |
| Molecular Formula | C13H9BrF3N3O2S |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 2-(4-bromophenyl)-2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)C(Sc1nc(C(F)(F)F)cc(=O)[nH]1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H9BrF3N3O2S/c14-7-3-1-6(2-4-7)10(11(18)22)23-12-19-8(13(15,16)17)5-9(21)20-12/h1-5,10H,(H2,18,22)(H,19,20,21) |
| InChIKey | REJCTXWQEHTHCT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |