C16H16N4OS — CID 136712352
(5E)-3-benzyl-5-[(2-ethylpyrazol-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 136712352) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[(2-ethylpyrazol-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[(2-ethylpyrazol-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 136712352 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (5E)-3-benzyl-5-[(2-ethylpyrazol-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1nccc1/C=C1/NC(=S)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H16N4OS/c1-2-20-13(8-9-17-20)10-14-15(21)19(16(22)18-14)11-12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H,18,22)/b14-10+ |
| InChIKey | ACDWVTSHDLQCEQ-GXDHUFHOSA-N |
| XLogP | 2.16 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|