C19H15N3O2S — CID 136715683
6-methyl-3-[(E)-3-oxo-1,3-diphenylprop-1-enyl]sulfanyl-4H-1,2,4-triazin-5-one (PubChem CID 136715683) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is 6-methyl-3-[(E)-3-oxo-1,3-diphenylprop-1-enyl]sulfanyl-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-[(E)-3-oxo-1,3-diphenylprop-1-enyl]sulfanyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136715683 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 6-methyl-3-[(E)-3-oxo-1,3-diphenylprop-1-enyl]sulfanyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(S/C(=C/C(=O)c2ccccc2)c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C19H15N3O2S/c1-13-18(24)20-19(22-21-13)25-17(15-10-6-3-7-11-15)12-16(23)14-8-4-2-5-9-14/h2-12H,1H3,(H,20,22,24)/b17-12+ |
| InChIKey | SYDVVAOCZUEZLA-SFQUDFHCSA-N |
| XLogP | 3.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|