C17H17N3O3 — CID 136718435
5,6-dimethoxy-3-[(3-methylphenyl)diazenyl]-1H-indol-2-ol (PubChem CID 136718435) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 5,6-dimethoxy-3-[(3-methylphenyl)diazenyl]-1H-indol-2-ol.
| Compound Name | 5,6-dimethoxy-3-[(3-methylphenyl)diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 136718435 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5,6-dimethoxy-3-[(3-methylphenyl)diazenyl]-1H-indol-2-ol |
| SMILES | COc1cc2[nH]c(O)c(/N=N/c3cccc(C)c3)c2cc1OC |
| InChI | InChI=1S/C17H17N3O3/c1-10-5-4-6-11(7-10)19-20-16-12-8-14(22-2)15(23-3)9-13(12)18-17(16)21/h4-9,18,21H,1-3H3/b20-19+ |
| InChIKey | XIOPUSLRBOEUMD-FMQUCBEESA-N |
| XLogP | 4.61 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|