C21H21N6O11P — CID 136721472
[(2R,3S,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-2-[(6-nitro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] acetate (PubChem CID 136721472) has the molecular formula C21H21N6O11P and a molecular weight of 564.40 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-2-[(6-nitro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-2-[(6-nitro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 136721472 |
| Molecular Formula | C21H21N6O11P |
| Molecular Weight | 564.40 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | [(2R,3S,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-2-[(6-nitro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)Nc1nc2c(ncn2[C@H]2C[C@H](OC(C)=O)[C@@H](COP3(=O)OCc4cc([N+](=O)[O-])ccc4O3)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C21H21N6O11P/c1-10(28)23-21-24-19-18(20(30)25-21)22-9-26(19)17-6-15(36-11(2)29)16(37-17)8-35-39(33)34-7-12-5-13(27(31)32)3-4-14(12)38-39/h3-5,9,15-17H,6-8H2,1-2H3,(H2,23,24,25,28,30)/t15-,16+,17+,39?/m0/s1 |
| InChIKey | WCKKSETUPUSLSQ-PMQRHDGXSA-N |
| XLogP | 1.94 |
| TPSA | 216.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|