C37H42N4O4 — CID 136722218
26,38-dimethyl-11,14-dioxa-3,22,30,34-tetrazapentacyclo[34.3.1.124,28.05,10.015,20]hentetraconta-1(40),5,7,9,15,17,19,24(41),25,27,29,34,36,38-tetradecaene-40,41-diol (PubChem CID 136722218) has the molecular formula C37H42N4O4 and a molecular weight of 606.77 g/mol. Its IUPAC name is 26,38-dimethyl-11,14-dioxa-3,22,30,34-tetrazapentacyclo[34.3.1.124,28.05,10.015,20]hentetraconta-1(40),5,7,9,15,17,19,24(41),25,27,29,34,36,38-tetradecaene-40,41-diol.
| Compound Name | 26,38-dimethyl-11,14-dioxa-3,22,30,34-tetrazapentacyclo[34.3.1.124,28.05,10.015,20]hentetraconta-1(40),5,7,9,15,17,19,24(41),25,27,29,34,36,38-tetradecaene-40,41-diol |
|---|---|
| PubChem CID | 136722218 |
| Molecular Formula | C37H42N4O4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 26,38-dimethyl-11,14-dioxa-3,22,30,34-tetrazapentacyclo[34.3.1.124,28.05,10.015,20]hentetraconta-1(40),5,7,9,15,17,19,24(41),25,27,29,34,36,38-tetradecaene-40,41-diol |
| SMILES | Cc1cc2c(O)c(c1)CNCc1ccccc1OCCOc1ccccc1CNCc1cc(C)cc(c1O)/C=N\CCC/N=C\2 |
| InChI | InChI=1S/C37H42N4O4/c1-26-16-30-22-38-12-7-13-39-23-31-17-27(2)19-33(37(31)43)25-41-21-29-9-4-6-11-35(29)45-15-14-44-34-10-5-3-8-28(34)20-40-24-32(18-26)36(30)42/h3-6,8-11,16-19,22-23,40-43H,7,12-15,20-21,24-25H2,1-2H3/b38-22-,39-23- |
| InChIKey | MXRCJMNTASXGPS-RFSISCEKSA-N |
| XLogP | 5.99 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|