C32H48N8O4 — CID 139198280
17,35-dimethyl-3,6,10,13,21,24,28,31-octazatricyclo[31.3.1.115,19]octatriaconta-1(36),2,13,15,17,19(38),20,31,33(37),34-decaene-8,26,37,38-tetrol (PubChem CID 139198280) has the molecular formula C32H48N8O4 and a molecular weight of 608.79 g/mol. Its IUPAC name is 17,35-dimethyl-3,6,10,13,21,24,28,31-octazatricyclo[31.3.1.115,19]octatriaconta-1(36),2,13,15,17,19(38),20,31,33(37),34-decaene-8,26,37,38-tetrol.
| Compound Name | 17,35-dimethyl-3,6,10,13,21,24,28,31-octazatricyclo[31.3.1.115,19]octatriaconta-1(36),2,13,15,17,19(38),20,31,33(37),34-decaene-8,26,37,38-tetrol |
|---|---|
| PubChem CID | 139198280 |
| Molecular Formula | C32H48N8O4 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | 17,35-dimethyl-3,6,10,13,21,24,28,31-octazatricyclo[31.3.1.115,19]octatriaconta-1(36),2,13,15,17,19(38),20,31,33(37),34-decaene-8,26,37,38-tetrol |
| SMILES | Cc1cc2c(O)c(c1)/C=N/CCNCC(O)CNCC/N=C/c1cc(C)cc(c1O)/C=N\CCNCC(O)CNCC/N=C\2 |
| InChI | InChI=1S/C32H48N8O4/c1-23-11-25-15-33-3-7-37-19-29(41)21-39-9-5-35-17-27-13-24(2)14-28(32(27)44)18-36-6-10-40-22-30(42)20-38-8-4-34-16-26(12-23)31(25)43/h11-18,29-30,37-44H,3-10,19-22H2,1-2H3/b33-15-,34-16+,35-17-,36-18+ |
| InChIKey | KRWBKJDRQXWZCQ-VTLBRCPFSA-N |
| XLogP | 0.18 |
| TPSA | 178.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |