C24H30N6 — CID 12068296
3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(29),2,9,11(30),12,14,16,23,25,27-decaene (PubChem CID 12068296) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is 3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(29),2,9,11(30),12,14,16,23,25,27-decaene.
| Compound Name | 3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(29),2,9,11(30),12,14,16,23,25,27-decaene |
|---|---|
| PubChem CID | 12068296 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(29),2,9,11(30),12,14,16,23,25,27-decaene |
| SMILES | C1=N\CCNCC/N=C\c2cccc(c2)/C=N/CCNCC/N=C/c2cccc/1c2 |
| InChI | InChI=1S/C24H30N6/c1-3-21-15-22(4-1)18-28-12-8-26-10-14-30-20-24-6-2-5-23(16-24)19-29-13-9-25-7-11-27-17-21/h1-6,15-20,25-26H,7-14H2/b27-17-,28-18+,29-19-,30-20+ |
| InChIKey | RHXCKCZZOGQPMR-YCJBCEEDSA-N |
| XLogP | 2.26 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |