C48H60N12 — CID 139060986
(2R,16S)-3,6,9,17,20,23-hexazapentacyclo[23.3.1.111,15.02,6.016,20]triaconta-1(28),9,11(30),12,14,23,25(29),26-octaene (PubChem CID 139060986) has the molecular formula C48H60N12 and a molecular weight of 805.09 g/mol. Its IUPAC name is (2R,16S)-3,6,9,17,20,23-hexazapentacyclo[23.3.1.111,15.02,6.016,20]triaconta-1(28),9,11(30),12,14,23,25(29),26-octaene.
| Compound Name | (2R,16S)-3,6,9,17,20,23-hexazapentacyclo[23.3.1.111,15.02,6.016,20]triaconta-1(28),9,11(30),12,14,23,25(29),26-octaene |
|---|---|
| PubChem CID | 139060986 |
| Molecular Formula | C48H60N12 |
| Molecular Weight | 805.09 g/mol |
| Exact Mass | 804.51 |
| IUPAC Name | (2R,16S)-3,6,9,17,20,23-hexazapentacyclo[23.3.1.111,15.02,6.016,20]triaconta-1(28),9,11(30),12,14,23,25(29),26-octaene |
| SMILES | C1=N/CCN2CCN[C@@H]2c2cccc(c2)/C=N/CCN2CCN[C@H]2c2cccc/1c2.C1=N/CCN2CCN[C@@H]2c2cccc(c2)/C=N/CCN2CCN[C@H]2c2cccc/1c2 |
| InChI | InChI=1S/2C24H30N6/c2*1-3-19-15-21(5-1)23-27-9-13-29(23)11-8-26-18-20-4-2-6-22(16-20)24-28-10-14-30(24)12-7-25-17-19/h2*1-6,15-18,23-24,27-28H,7-14H2/b2*25-17+,26-18+/t2*23-,24+ |
| InChIKey | NRXBNABCKPPZRV-XKGUIBORSA-N |
| XLogP | 4.09 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.09 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |