C17H21N3O2 — CID 122205101
2,2-dimethyl-19,20-dioxa-8,11,14-triazatricyclo[14.2.1.13,6]icosa-1(18),3,5,7,14,16-hexaene (PubChem CID 122205101) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2,2-dimethyl-19,20-dioxa-8,11,14-triazatricyclo[14.2.1.13,6]icosa-1(18),3,5,7,14,16-hexaene.
| Compound Name | 2,2-dimethyl-19,20-dioxa-8,11,14-triazatricyclo[14.2.1.13,6]icosa-1(18),3,5,7,14,16-hexaene |
|---|---|
| PubChem CID | 122205101 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2,2-dimethyl-19,20-dioxa-8,11,14-triazatricyclo[14.2.1.13,6]icosa-1(18),3,5,7,14,16-hexaene |
| SMILES | CC1(C)c2ccc(o2)/C=N\CCNCC/N=C/c2ccc1o2 |
| InChI | InChI=1S/C17H21N3O2/c1-17(2)15-5-3-13(21-15)11-19-9-7-18-8-10-20-12-14-4-6-16(17)22-14/h3-6,11-12,18H,7-10H2,1-2H3/b19-11-,20-12+ |
| InChIKey | LFTLOFHEXHMWSP-UHWBUFEVSA-N |
| XLogP | 2.64 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |