C8H14N2 — CID 118457648
2,8-diazaspiro[4.5]dec-1-ene (PubChem CID 118457648) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,8-diazaspiro[4.5]dec-1-ene.
| Compound Name | 2,8-diazaspiro[4.5]dec-1-ene |
|---|---|
| PubChem CID | 118457648 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2,8-diazaspiro[4.5]dec-1-ene |
| SMILES | C1=NCCC12CCNCC2 |
| InChI | InChI=1S/C8H14N2/c1-4-9-5-2-8(1)3-6-10-7-8/h7,9H,1-6H2 |
| InChIKey | DPHLZQXCPCWPAF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |