C9H15IN2 — CID 167040422
3-iodo-3,9-diazaspiro[5.5]undec-4-ene (PubChem CID 167040422) has the molecular formula C9H15IN2 and a molecular weight of 278.14 g/mol. Its IUPAC name is 3-iodo-3,9-diazaspiro[5.5]undec-4-ene.
| Compound Name | 3-iodo-3,9-diazaspiro[5.5]undec-4-ene |
|---|---|
| PubChem CID | 167040422 |
| Molecular Formula | C9H15IN2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-iodo-3,9-diazaspiro[5.5]undec-4-ene |
| SMILES | IN1C=CC2(CCNCC2)CC1 |
| InChI | InChI=1S/C9H15IN2/c10-12-7-3-9(4-8-12)1-5-11-6-2-9/h3,7,11H,1-2,4-6,8H2 |
| InChIKey | PHFFGYWNVTUJMK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|