C26H34N6S2 — CID 136903434
13,27-dimethyl-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),2,9,11,13,15(30),16,23,25(29),26-decaene-29,30-dithiol (PubChem CID 136903434) has the molecular formula C26H34N6S2 and a molecular weight of 494.73 g/mol. Its IUPAC name is 13,27-dimethyl-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),2,9,11,13,15(30),16,23,25(29),26-decaene-29,30-dithiol.
| Compound Name | 13,27-dimethyl-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),2,9,11,13,15(30),16,23,25(29),26-decaene-29,30-dithiol |
|---|---|
| PubChem CID | 136903434 |
| Molecular Formula | C26H34N6S2 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 13,27-dimethyl-3,6,9,17,20,23-hexazatricyclo[23.3.1.111,15]triaconta-1(28),2,9,11,13,15(30),16,23,25(29),26-decaene-29,30-dithiol |
| SMILES | Cc1cc2c(S)c(c1)/C=N\CCNCC/N=C/c1cc(C)cc(c1S)/C=N/CCNCC/N=C\2 |
| InChI | InChI=1S/C26H34N6S2/c1-19-11-21-15-29-7-3-27-5-9-31-17-23-13-20(2)14-24(26(23)34)18-32-10-6-28-4-8-30-16-22(12-19)25(21)33/h11-18,27-28,33-34H,3-10H2,1-2H3/b29-15-,30-16-,31-17+,32-18+ |
| InChIKey | NQNWHBSKJFXDGY-KNLLVIIOSA-N |
| XLogP | 3.45 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|