C12H17ClN2 — CID 71071019
2-chloro-1,3,5-trimethylbenzene;4,5-dihydro-1H-imidazole (PubChem CID 71071019) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 2-chloro-1,3,5-trimethylbenzene;4,5-dihydro-1H-imidazole.
| Compound Name | 2-chloro-1,3,5-trimethylbenzene;4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 71071019 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-chloro-1,3,5-trimethylbenzene;4,5-dihydro-1H-imidazole |
| SMILES | C1=NCCN1.Cc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C9H11Cl.C3H6N2/c1-6-4-7(2)9(10)8(3)5-6;1-2-5-3-4-1/h4-5H,1-3H3;3H,1-2H2,(H,4,5) |
| InChIKey | YPXHTACDANOZFC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |