C8H8N2 — CID 158638402
3-methyl-7H-pyrrolo[3,4-b]pyridine (PubChem CID 158638402) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 3-methyl-7H-pyrrolo[3,4-b]pyridine.
| Compound Name | 3-methyl-7H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 158638402 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 3-methyl-7H-pyrrolo[3,4-b]pyridine |
| SMILES | Cc1cnc2c(c1)C=NC2 |
| InChI | InChI=1S/C8H8N2/c1-6-2-7-4-9-5-8(7)10-3-6/h2-4H,5H2,1H3 |
| InChIKey | URHLETVDNQGHKE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |