C13H11N3O4 — CID 136726174
2-hydroxy-3-(2-hydroxyanilino)-6-imino-5-oxocyclohexa-1,3-diene-1-carboxamide (PubChem CID 136726174) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-hydroxy-3-(2-hydroxyanilino)-6-imino-5-oxocyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 2-hydroxy-3-(2-hydroxyanilino)-6-imino-5-oxocyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 136726174 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-hydroxy-3-(2-hydroxyanilino)-6-imino-5-oxocyclohexa-1,3-diene-1-carboxamide |
| SMILES | [H]/N=C1\C(=O)C=C(Nc2ccccc2O)C(O)=C1C(N)=O |
| InChI | InChI=1S/C13H11N3O4/c14-11-9(18)5-7(12(19)10(11)13(15)20)16-6-3-1-2-4-8(6)17/h1-5,14,16-17,19H,(H2,15,20)/b14-11+ |
| InChIKey | SEONSXGJDVCLRR-SDNWHVSQSA-N |
| XLogP | 0.59 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|