C17H22FN5O2 — CID 136727618
(6R)-6-[[3-(2-fluorophenoxy)propylamino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136727618) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is (6R)-6-[[3-(2-fluorophenoxy)propylamino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (6R)-6-[[3-(2-fluorophenoxy)propylamino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136727618 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (6R)-6-[[3-(2-fluorophenoxy)propylamino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC(=O)c1cnn2c1NC[C@@H](CNCCCOc1ccccc1F)C2 |
| InChI | InChI=1S/C17H22FN5O2/c18-14-4-1-2-5-15(14)25-7-3-6-20-8-12-9-21-17-13(16(19)24)10-22-23(17)11-12/h1-2,4-5,10,12,20-21H,3,6-9,11H2,(H2,19,24)/t12-/m1/s1 |
| InChIKey | JLALDYCKCBJOEX-GFCCVEGCSA-N |
| XLogP | 1.22 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|