C19H18N6OS — CID 136736946
3-(4-ethoxyphenyl)-4-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-1,2,4-triazole-5-thione (PubChem CID 136736946) has the molecular formula C19H18N6OS and a molecular weight of 378.46 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-4-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-ethoxyphenyl)-4-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136736946 |
| Molecular Formula | C19H18N6OS |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-(4-ethoxyphenyl)-4-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccc(-c2n[nH]c(=S)n2N/N=C\c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C19H18N6OS/c1-2-26-15-9-7-13(8-10-15)18-22-23-19(27)25(18)24-21-12-14-11-20-17-6-4-3-5-16(14)17/h3-12,20,24H,2H2,1H3,(H,23,27)/b21-12- |
| InChIKey | FIUNAXYNQXXTLM-MTJSOVHGSA-N |
| XLogP | 4.07 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|