C12H11NO5 — CID 136741844
ethyl 5-hydroxy-3-oxo-2-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 136741844) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is ethyl 5-hydroxy-3-oxo-2-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-hydroxy-3-oxo-2-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 136741844 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | ethyl 5-hydroxy-3-oxo-2-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(O)on(-c2ccccc2)c1=O |
| InChI | InChI=1S/C12H11NO5/c1-2-17-11(15)9-10(14)13(18-12(9)16)8-6-4-3-5-7-8/h3-7,16H,2H2,1H3 |
| InChIKey | CFFIRSGLEPLURD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |