C7H10 — CID 136742471
(1R,5S,6S,7R)-6,7-dideuteriobicyclo[3.2.0]hept-2-ene (PubChem CID 136742471) has the molecular formula C7H10 and a molecular weight of 96.17 g/mol. Its IUPAC name is (1R,5S,6S,7R)-6,7-dideuteriobicyclo[3.2.0]hept-2-ene.
| Compound Name | (1R,5S,6S,7R)-6,7-dideuteriobicyclo[3.2.0]hept-2-ene |
|---|---|
| PubChem CID | 136742471 |
| Molecular Formula | C7H10 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | (1R,5S,6S,7R)-6,7-dideuteriobicyclo[3.2.0]hept-2-ene |
| SMILES | [2H][C@@H]1[C@H]([2H])[C@H]2CC=C[C@H]12 |
| InChI | InChI=1S/C7H10/c1-2-6-4-5-7(6)3-1/h1-2,6-7H,3-5H2/t6-,7-/m1/s1/i4D,5D/t4-,5+,6-,7- |
| InChIKey | SLCAVPTUVCCIIB-AJWMPYJDSA-N |
| XLogP | 1.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|